Wiley SpectraBase; SpectraBase Compound ID=8EMWltAtlFA
http://spectrabase.com/compound/8EMWltAtlFA (accessed Jul 11, 2020).

REFERENCE
SpectraBase Compound ID 8EMWltAtlFA
InChI InChI=1S/C14H16N2O/c15-10-12-8-4-5-9-13(12)16-14(17)11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-9H2,(H,16,17)/t12-,13-/m0/s1
InChIKey RWEFRCCKBNLQSX-STQMWFEESA-N
Mol Weight 228.29 g/mol
Molecular Formula C14H16N2O
Exact Mass 228.126263 g/mol
Enantiomer InChIKey RWEFRCCKBNLQSX-CHWSQXEVSA-N