Wiley SpectraBase; SpectraBase Compound ID=7yMrk2IemZl
http://spectrabase.com/compound/7yMrk2IemZl (accessed Jul 15, 2020).

3-(4-NITROPHENYL)-GLUTARIC-ANHYDRIDE
SpectraBase Compound ID 7yMrk2IemZl
InChI InChI=1S/C11H9NO5/c13-10-5-8(6-11(14)17-10)7-1-3-9(4-2-7)12(15)16/h1-4,8H,5-6H2
InChIKey MFVQOCMEHLITHQ-UHFFFAOYSA-N
Mol Weight 235.19 g/mol
Molecular Formula C11H9NO5
Exact Mass 235.048073 g/mol