Wiley SpectraBase; SpectraBase Compound ID=7pchVmWtzF9
http://spectrabase.com/compound/7pchVmWtzF9 (accessed Sep 27, 2020).

SpectraBase Compound ID 7pchVmWtzF9
InChI InChI=1S/C9H17N/c1-2-9-4-3-7(6-9)5-8(9)10/h7-8H,2-6,10H2,1H3/t7-,8-,9-/m0/s1
Mol Weight 139.24 g/mol
Molecular Formula C9H17N
Exact Mass 139.1361 g/mol