Wiley SpectraBase; SpectraBase Compound ID=7lwmME9URRc
http://spectrabase.com/compound/7lwmME9URRc (accessed Oct 27, 2020).

1-(1-cyclopentenyl)cyclopentene
SpectraBase Compound ID 7lwmME9URRc
InChI InChI=1S/C10H14/c1-2-6-9(5-1)10-7-3-4-8-10/h5,7H,1-4,6,8H2
InChIKey PUARQURWMXSDAB-UHFFFAOYSA-N
Mol Weight 134.22 g/mol
Molecular Formula C10H14
Exact Mass 134.109551 g/mol