Wiley SpectraBase; SpectraBase Compound ID=7d6QJcrWW1q
http://spectrabase.com/compound/7d6QJcrWW1q (accessed Jul 15, 2020).

SpectraBase Compound ID 7d6QJcrWW1q
InChI InChI=1S/C7H10O/c1-2-5-3-4(1)6-7(5)8-6/h4-7H,1-3H2/t4-,5+,6?,7?
Mol Weight 110.16 g/mol
Molecular Formula C7H10O
Exact Mass 110.073165 g/mol