Wiley SpectraBase; SpectraBase Compound ID=7P4VUT6q8Ba
http://spectrabase.com/compound/7P4VUT6q8Ba (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID 7P4VUT6q8Ba
InChI InChI=1S/C14H17NO3/c16-13(10-6-2-1-3-7-10)15-12-9-5-4-8-11(12)14(17)18/h1-3,6-7,11-12H,4-5,8-9H2,(H,15,16)(H,17,18)/t11-,12-/m1/s1
InChIKey PUANNVQABXUYKU-VXGBXAGGSA-N
Mol Weight 247.29 g/mol
Molecular Formula C14H17NO3
Exact Mass 247.120844 g/mol
Enantiomer InChIKey PUANNVQABXUYKU-RYUDHWBXSA-N