Wiley SpectraBase; SpectraBase Compound ID=7FCaqsHVF
http://spectrabase.com/compound/7FCaqsHVF (accessed Aug 05, 2020).

SpectraBase Compound ID 7FCaqsHVF
InChI InChI=1S/C17H16N2O2/c20-16(21)11-13-10-12-6-4-5-9-15(12)17(13)19-18-14-7-2-1-3-8-14/h1-9,13,18H,10-11H2,(H,20,21)/b19-17+
Mol Weight 280.33 g/mol
Molecular Formula C17H16N2O2
Exact Mass 280.121178 g/mol