Wiley SpectraBase; SpectraBase Compound ID=6lgEFUjNu
http://spectrabase.com/compound/6lgEFUjNu (accessed Oct 24, 2020).

SpectraBase Compound ID 6lgEFUjNu
InChI InChI=1S/C10H13NOS/c1-12-9-2-3-10-8(6-9)7-11-4-5-13-10/h2-3,6,11H,4-5,7H2,1H3
Mol Weight 195.28 g/mol
Molecular Formula C10H13NOS
Exact Mass 195.071786 g/mol