Wiley SpectraBase; SpectraBase Compound ID=6YP6wiGit5e
http://spectrabase.com/compound/6YP6wiGit5e (accessed Jul 14, 2020).

(1R,2S)-2-HYDROXYCYCLOPENTANECARBOXAMIDE
SpectraBase Compound ID 6YP6wiGit5e
InChI InChI=1S/C6H11NO2/c7-6(9)4-2-1-3-5(4)8/h4-5,8H,1-3H2,(H2,7,9)/t4-,5+/m1/s1
InChIKey XLPNKXDLOYEHIM-UHNVWZDZSA-N
Mol Weight 129.16 g/mol
Molecular Formula C6H11NO2
Exact Mass 129.078979 g/mol
Enantiomer InChIKey XLPNKXDLOYEHIM-CRCLSJGQSA-N