Wiley SpectraBase; SpectraBase Compound ID=6UlTos79E5S
http://spectrabase.com/compound/6UlTos79E5S (accessed Aug 07, 2020).

2-HYDROXYMETHYL-BENZO-[B]-TELLUROPHEN
SpectraBase Compound ID 6UlTos79E5S
InChI InChI=1S/C9H8OTe/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5,10H,6H2
InChIKey VYYMHALCHDYQSC-UHFFFAOYSA-N
Mol Weight 259.76 g/mol
Molecular Formula C9H8OTe
Exact Mass 261.963744 g/mol