Wiley SpectraBase; SpectraBase Compound ID=6R93ojpyquH
http://spectrabase.com/compound/6R93ojpyquH (accessed Aug 07, 2020).

1-DEUTERO-3-METHYLENE-CYCLOBUTYLAMINE-HYDROCHLORIDE
SpectraBase Compound ID 6R93ojpyquH
InChI InChI=1S/C5H9N.ClH/c1-4-2-5(6)3-4;/h5H,1-3,6H2;1H/i5D;
InChIKey FGPMQNALZVYKPH-KXUUBAJSSA-N
Mol Weight 120.6 g/mol
Molecular Formula C5H92HClN
Exact Mass 120.056454 g/mol
Parent InChIKey CCDBTPTWKSVCET-UICOGKGYSA-N