Wiley SpectraBase; SpectraBase Compound ID=6AjCWK5og50
http://spectrabase.com/compound/6AjCWK5og50 (accessed Oct 24, 2020).

TRI-(N-BUTYL)-TIN-(IV)-[3-[(2',6'-DIETHYLPHENYLAMIDO)]-PROPANOATE]
SpectraBase Compound ID 6AjCWK5og50
InChI InChI=1S/C14H19NO3.3C4H9.Sn/c1-3-10-6-5-7-11(4-2)14(10)15-12(16)8-9-13(17)18;3*1-3-4-2;/h5-7H,3-4,8-9H2,1-2H3,(H,15,16)(H,17,18);3*1,3-4H2,2H3;/q;;;;+1/p-1
InChIKey ZSUKMRGKWTXUNZ-UHFFFAOYSA-M
Mol Weight 538.4 g/mol
Molecular Formula C26H45NO3Sn
Exact Mass 539.242144 g/mol
Parent InChIKey APWDJUOPXVGXNR-UHFFFAOYSA-M