Wiley SpectraBase; SpectraBase Compound ID=57zHf55UtQS
http://spectrabase.com/compound/57zHf55UtQS (accessed Jul 15, 2020).

SpectraBase Compound ID 57zHf55UtQS
InChI InChI=1S/C17H22O5/c1-4-5-6-7-15-16(21-11(2)18)14-10-12(20-3)8-9-13(14)17(19)22-15/h8-10,15-16H,4-7H2,1-3H3/t15-,16-/m1/s1
Mol Weight 306.36 g/mol
Molecular Formula C17H22O5
Exact Mass 306.146724 g/mol