Wiley SpectraBase; SpectraBase Compound ID=56sVHFPfDqx
http://spectrabase.com/compound/56sVHFPfDqx (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID 56sVHFPfDqx
InChI InChI=1S/C15H20N2O3/c16-14(18)12-7-4-8-13(9-12)17-15(19)20-10-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10H2,(H2,16,18)(H,17,19)/t12-,13-/m1/s1
InChIKey NPABYTUPAVMMGE-CHWSQXEVSA-N
Mol Weight 276.34 g/mol
Molecular Formula C15H20N2O3
Exact Mass 276.147393 g/mol
Enantiomer InChIKey NPABYTUPAVMMGE-STQMWFEESA-N