SpectraBase Compound ID | 4yUIIIOZU2i |
---|---|
InChI | InChI=1S/C8H12/c1-6-7-2-3-8(6)5-4-7/h2-3,6-8H,4-5H2,1H3/t6-,7-,8+ |
InChIKey | AVFRNNALLLVPGJ-WHUPJOBBSA-N |
Mol Weight | 108.18 g/mol |
Molecular Formula | C8H12 |
Exact Mass | 108.0939 g/mol |
Title | Journal or Book | Year |
---|---|---|
Nuclear magnetic resonance spectroscopy. Carbon-13 chemical shifts in norbornyl derivatives | Journal of the American Chemical Society | 1970 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software