Wiley SpectraBase; SpectraBase Compound ID=4wwSIUWNv6j
http://spectrabase.com/compound/4wwSIUWNv6j (accessed Oct 19, 2020).

(E)-6-CHLORO-10,11-DEHYDROCURVULARIN
SpectraBase Compound ID 4wwSIUWNv6j
InChI InChI=1S/C16H17ClO5/c1-9-5-3-2-4-6-11(18)14-10(8-13(20)22-9)7-12(19)15(17)16(14)21/h4,6-7,9,19,21H,2-3,5,8H2,1H3/b6-4+/t9-/m0/s1
InChIKey UQSXUWXEMMUFMK-DNQSNQRASA-N
Mol Weight 324.76 g/mol
Molecular Formula C16H17ClO5
Exact Mass 324.076452 g/mol
Enantiomer InChIKey UQSXUWXEMMUFMK-OTQAPUNGSA-N
Racemate InChIKey UQSXUWXEMMUFMK-GQCTYLIASA-N