SpectraBase Compound ID | 4nXFMX8WUw0 |
---|---|
InChI | InChI=1S/C25H43NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-22-25(27)26-23-20-18-21-24-26/h4-5,16-17,19,22H,2-3,6-15,18,20-21,23-24H2,1H3/b5-4-,17-16+,22-19+ |
InChIKey | MKEWSYYOWWKTAK-AEPHKGLBSA-N |
Mol Weight | 373.6 g/mol |
Molecular Formula | C25H43NO |
Exact Mass | 373.334465 g/mol |
Title | Journal or Book | Year |
---|---|---|
Piperidine alkaloids from Piper retrofractum fruits | Phytochemistry | 1992 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software