Wiley SpectraBase; SpectraBase Compound ID=4gah0F3MMKb
http://spectrabase.com/compound/4gah0F3MMKb (accessed Jul 15, 2020).

SpectraBase Compound ID 4gah0F3MMKb
InChI InChI=1S/C9H17N/c1-2-9-4-3-7(6-9)5-8(9)10/h7-8H,2-6,10H2,1H3/t7-,8+,9-/m0/s1
Mol Weight 139.24 g/mol
Molecular Formula C9H17N
Exact Mass 139.1361 g/mol