Wiley SpectraBase; SpectraBase Compound ID=4N4r3X27DDA
http://spectrabase.com/compound/4N4r3X27DDA (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID 4N4r3X27DDA
InChI InChI=1S/C6H10O3/c7-5-3-1-2-4(5)6(8)9/h4-5,7H,1-3H2,(H,8,9)/t4-,5+/m1/s1
InChIKey VCHGSWURBGPKQZ-UHNVWZDZSA-N
Mol Weight 130.14 g/mol
Molecular Formula C6H10O3
Exact Mass 130.062994 g/mol
Enantiomer InChIKey VCHGSWURBGPKQZ-CRCLSJGQSA-N