SpectraBase Compound ID | 3u7KvN8aa6Y |
---|---|
InChI | InChI=1S/C14H15NO3S2/c1-3-18-13(17)11-12(16)15(14(19)20-11)8-10-6-4-9(2)5-7-10/h4-7,11H,3,8H2,1-2H3 |
InChIKey | HFCYKFJEHXIRRZ-UHFFFAOYSA-N |
Mol Weight | 309.4 g/mol |
Molecular Formula | C14H15NO3S2 |
Exact Mass | 309.049337 g/mol |
Title | Journal or Book | Year |
---|---|---|
Efficient synthesis of ethyl 3-alkyl-4-oxo-2-thioxo-1,3-thiazolane-5-carboxylates from the reaction of carbon disulfide and primary amines in the presence of diethyl 2-chloromalonate | Monatshefte für Chemie - Chemical Monthly | 2008 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software