Wiley SpectraBase; SpectraBase Compound ID=3eFlQLxVbX4
http://spectrabase.com/compound/3eFlQLxVbX4 (accessed Oct 27, 2020).

HODGSONOX_D;[(1R,3S,6R,7AR)-(+)-3-ETHENYL-1-METHYL-6-(1-METHYLETHYL)-5-OXO-HEXAHYDROCYCLOPENTA-[C]-PYRAN-4-YL]-METHYL_ACETATE
SpectraBase Compound ID 3eFlQLxVbX4
InChI InChI=1S/C17H26O4/c1-6-15-14(8-20-11(5)18)16-13(10(4)21-15)7-12(9(2)3)17(16)19/h6,9-10,12-13,15,17,19H,1,7-8H2,2-5H3/t10-,12-,13+,15+,17-/m0/s1
InChIKey LGRRZBIIUKBQSK-PFFLZGHSSA-N
Mol Weight 294.39 g/mol
Molecular Formula C17H26O4
Exact Mass 294.18311 g/mol
Enantiomer InChIKey LGRRZBIIUKBQSK-MGGIWROYSA-N