Wiley SpectraBase; SpectraBase Compound ID=3YX31JFZIrc
http://spectrabase.com/compound/3YX31JFZIrc (accessed Jul 15, 2020).

SpectraBase Compound ID 3YX31JFZIrc
InChI InChI=1S/C9H16O/c1-9-5-4-7(6-9)2-3-8(9)10/h7-8,10H,2-6H2,1H3/t7-,8-,9+/m1/s1
Mol Weight 140.23 g/mol
Molecular Formula C9H16O
Exact Mass 140.120115 g/mol