Wiley SpectraBase; SpectraBase Compound ID=2yiYf9DQI2T
http://spectrabase.com/compound/2yiYf9DQI2T (accessed Oct 24, 2020).

2,10-DIHYDRO-2-METHYL-1H-PYRIDAZINO[4,5-b][1,4]BENZOTHIAZIN-1-ONE
SpectraBase Compound ID 2yiYf9DQI2T
InChI InChI=1S/C11H9N3OS/c1-14-11(15)10-9(6-12-14)16-8-5-3-2-4-7(8)13-10/h2-6,13H,1H3
InChIKey MTWNJXIKMKFISJ-UHFFFAOYSA-N
Mol Weight 231.27 g/mol
Molecular Formula C11H9N3OS
Exact Mass 231.046634 g/mol