Wiley SpectraBase; SpectraBase Compound ID=2rY1d9GRBF2
http://spectrabase.com/compound/2rY1d9GRBF2 (accessed Jul 11, 2020).

3-HYDROXY-LYSINE
SpectraBase Compound ID 2rY1d9GRBF2
InChI InChI=1S/C6H14N2O3/c7-3-1-2-4(9)5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4-,5+/m1/s1
InChIKey YSVMULOOWPBERR-UHNVWZDZSA-N
Mol Weight 162.19 g/mol
Molecular Formula C6H14N2O3
Exact Mass 162.100442 g/mol
Enantiomer InChIKey YSVMULOOWPBERR-CRCLSJGQSA-N