SpectraBase Compound ID | 2jJbRR83PS2 |
---|---|
InChI | InChI=1S/C17H14O5/c1-20-13-8-7-10(9-14(13)21-2)17-16(19)15(18)11-5-3-4-6-12(11)22-17/h3-9,19H,1-2H3 |
InChIKey | BXLAVJWSFYZDPF-UHFFFAOYSA-N |
Mol Weight | 298.29 g/mol |
Molecular Formula | C17H14O5 |
Exact Mass | 298.084124 g/mol |
Title | Journal or Book | Year |
---|---|---|
13C NMR Spectroscopy of Flavonoids | HETEROCYCLES | 1981 |
10.1002/1521-4184(20007)333:7<205::aid-ardp205>3.3.co;2-p | "" | "" |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software