Wiley SpectraBase; SpectraBase Compound ID=2hHiAjNni7H
http://spectrabase.com/compound/2hHiAjNni7H (accessed Aug 07, 2020).

ANGELICOIN-A
SpectraBase Compound ID 2hHiAjNni7H
InChI InChI=1S/C15H18O4/c1-8(2)4-5-11-12(16)7-10-6-9(3)19-15(18)13(10)14(11)17/h4,7,9,16-17H,5-6H2,1-3H3/t9-/m1/s1
InChIKey CKMVXXQCWONCIA-SECBINFHSA-N
Mol Weight 262.3 g/mol
Molecular Formula C15H18O4
Exact Mass 262.120509 g/mol
Enantiomer InChIKey CKMVXXQCWONCIA-VIFPVBQESA-N
Racemate InChIKey CKMVXXQCWONCIA-UHFFFAOYSA-N