SpectraBase Compound ID | 2eV7c751mwi |
---|---|
InChI | InChI=1S/C7H13NO3/c9-2-1-7(5-10)8-3-6(8)4-11-7/h6,9-10H,1-5H2 |
InChIKey | HNKCUXNMVBOVTI-UHFFFAOYSA-N |
Mol Weight | 159.18 g/mol |
Molecular Formula | C7H13NO3 |
Exact Mass | 159.089543 g/mol |
Title | Journal or Book | Year |
---|---|---|
Derivatives of heterocyclic ?-iminocarboxylic acids. 4. Reduction of N-alkoxycarbonyl derivatives of ?-iminocarboxylic acids | Chemistry of Heterocyclic Compounds | 1993 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software