Wiley SpectraBase; SpectraBase Compound ID=2ZV24V3ZCp
http://spectrabase.com/compound/2ZV24V3ZCp (accessed Oct 28, 2020).

[1,3-DI-(4-FLUOROPHENYL)-PYRAZOL-5-YL]-ACETONITRILE
SpectraBase Compound ID 2ZV24V3ZCp
InChI InChI=1S/C17H11F2N3/c18-13-3-1-12(2-4-13)17-11-16(9-10-20)22(21-17)15-7-5-14(19)6-8-15/h1-8,11H,9H2
InChIKey CYULNOQESHPIPY-UHFFFAOYSA-N
Mol Weight 295.29 g/mol
Molecular Formula C17H11F2N3
Exact Mass 295.092104 g/mol