Wiley SpectraBase; SpectraBase Compound ID=2YAdJyoIwH
http://spectrabase.com/compound/2YAdJyoIwH (accessed Oct 25, 2020).

1,1-BIS-(DIMETHYLAMINO)-2,2-DICYANOETHENE
SpectraBase Compound ID 2YAdJyoIwH
InChI InChI=1S/C8H12N4/c1-11(2)8(12(3)4)7(5-9)6-10/h1-4H3
InChIKey GRPULZMNGWULPL-UHFFFAOYSA-N
Mol Weight 164.21 g/mol
Molecular Formula C8H12N4
Exact Mass 164.106196 g/mol