Wiley SpectraBase; SpectraBase Compound ID=2Y1ivX5DYE
http://spectrabase.com/compound/2Y1ivX5DYE (accessed Oct 25, 2020).

2-METHYL-2-PHOSPHATETRACYCLO-[3.2.1.0(3,6).0(4,7)]-OCTANE-2-OXIDE
SpectraBase Compound ID 2Y1ivX5DYE
InChI InChI=1S/C8H11OP/c1-10(9)7-4-2-3-5(7)6(3)8(4)10/h3-8H,2H2,1H3/t3-,4-,5+,6-,7-,8+,10+
InChIKey QUJNMDPLBMIQMS-FWHZBLGESA-N
Mol Weight 154.15 g/mol
Molecular Formula C8H11OP
Exact Mass 154.054753 g/mol