Wiley SpectraBase; SpectraBase Compound ID=2VbEizGuPy
http://spectrabase.com/compound/2VbEizGuPy (accessed Oct 27, 2020).

6-(2-methylphenyl)benzo[c][1,2]benzoxaphosphinine
SpectraBase Compound ID 2VbEizGuPy
InChI InChI=1S/C19H15OP/c1-14-8-2-6-12-18(14)21-19-13-7-4-10-16(19)15-9-3-5-11-17(15)20-21/h2-13H,1H3
InChIKey MNJRNSHWNPQQLU-UHFFFAOYSA-N
Mol Weight 290.3 g/mol
Molecular Formula C19H15OP
Exact Mass 290.086054 g/mol