Wiley SpectraBase; SpectraBase Compound ID=2PRdopBKVZ
http://spectrabase.com/compound/2PRdopBKVZ (accessed Oct 26, 2020).

3-aminopyrazinecarboxy-p-phenetidide
SpectraBase Compound ID 2PRdopBKVZ
InChI InChI=1S/C13H14N4O2/c1-2-19-10-5-3-9(4-6-10)17-13(18)11-12(14)16-8-7-15-11/h3-8H,2H2,1H3,(H2,14,16)(H,17,18)
InChIKey QYKZGJQAVAASGL-UHFFFAOYSA-N
Mol Weight 258.28 g/mol
Molecular Formula C13H14N4O2
Exact Mass 258.111676 g/mol