Wiley SpectraBase; SpectraBase Compound ID=2Nu3ndt943
http://spectrabase.com/compound/2Nu3ndt943 (accessed Oct 20, 2020).

BICYCLO-[6.3.0]-UNDECA-1(8),4-DIEN-4-YL-PROPIONATE
SpectraBase Compound ID 2Nu3ndt943
InChI InChI=1S/C14H20O2/c1-2-14(15)16-13-8-4-7-11-5-3-6-12(11)9-10-13/h8H,2-7,9-10H2,1H3/b13-8+
InChIKey ABBZOAZDRQRRTJ-MDWZMJQESA-N
Mol Weight 220.31 g/mol
Molecular Formula C14H20O2
Exact Mass 220.14633 g/mol