Wiley SpectraBase; SpectraBase Compound ID=2NpdsAh94D
http://spectrabase.com/compound/2NpdsAh94D (accessed Oct 28, 2020).

COSTUNOLIDE,2-A,8-B-DIHYDROXY-A
SpectraBase Compound ID 2NpdsAh94D
InChI InChI=1S/C15H20O4/c1-8-4-11(16)5-9(2)7-13-14(12(17)6-8)10(3)15(18)19-13/h4,7,11-14,16-17H,3,5-6H2,1-2H3/b8-4+,9-7+/t11-,12-,13-,14-/m1/s1
InChIKey FGJATCOCAOQTBA-VQWQNFJWSA-N
Mol Weight 264.32 g/mol
Molecular Formula C15H20O4
Exact Mass 264.136159 g/mol
Enantiomer InChIKey FGJATCOCAOQTBA-YVZWNEPBSA-N