Wiley SpectraBase; SpectraBase Compound ID=2JRvO0B6mo
http://spectrabase.com/compound/2JRvO0B6mo (accessed Oct 26, 2020).

acetic acid [4-[(E)-3-[(2-hydroxy-5-keto-1-cyclopentenyl)amino]-3-keto-prop-1-enyl]-2,3-dihydrofuran-2-yl] ester
SpectraBase Compound ID 2JRvO0B6mo
InChI InChI=1S/C14H15NO6/c1-8(16)21-13-6-9(7-20-13)2-5-12(19)15-14-10(17)3-4-11(14)18/h2,5,7,13,17H,3-4,6H2,1H3,(H,15,19)/b5-2+
InChIKey VKXPFUZQXMQEDU-GORDUTHDSA-N
Mol Weight 293.28 g/mol
Molecular Formula C14H15NO6
Exact Mass 293.089937 g/mol