Wiley SpectraBase; SpectraBase Compound ID=2CVp9oG9fG
http://spectrabase.com/compound/2CVp9oG9fG (accessed Oct 28, 2020).

(+/-)-DASYCARPIDONE
SpectraBase Compound ID 2CVp9oG9fG
InChI InChI=1S/C17H20N2O/c1-3-10-11-8-9-19(2)16(10)14-12-6-4-5-7-13(12)18-15(14)17(11)20/h4-7,10-11,16,18H,3,8-9H2,1-2H3/t10?,11-,16+/m0/s1
InChIKey UQEIPRLKBQFHLY-NLONXFEPSA-N
Mol Weight 268.36 g/mol
Molecular Formula C17H20N2O
Exact Mass 268.157563 g/mol
Enantiomer InChIKey UQEIPRLKBQFHLY-KGLDEUSLSA-N