Wiley SpectraBase; SpectraBase Compound ID=2CUcxsrQzi
http://spectrabase.com/compound/2CUcxsrQzi (accessed Oct 25, 2020).

1-(PIPERIDIN-1-YL-METHYL)-CYCLOPENTANOL
SpectraBase Compound ID 2CUcxsrQzi
InChI InChI=1S/C11H21NO/c13-11(6-2-3-7-11)10-12-8-4-1-5-9-12/h13H,1-10H2
InChIKey ZYNNNYJEBOCYGG-UHFFFAOYSA-N
Mol Weight 183.29 g/mol
Molecular Formula C11H21NO
Exact Mass 183.162314 g/mol