Wiley SpectraBase; SpectraBase Compound ID=265ZgyCFNA
http://spectrabase.com/compound/265ZgyCFNA (accessed Oct 27, 2020).

1-[(p-PHENETIDINO)METHYL]-1H-BENZOTRIAZOLE
SpectraBase Compound ID 265ZgyCFNA
InChI InChI=1S/C15H16N4O/c1-2-20-13-9-7-12(8-10-13)16-11-19-15-6-4-3-5-14(15)17-18-19/h3-10,16H,2,11H2,1H3
InChIKey VTDNNHPUCHPVGZ-UHFFFAOYSA-N
Mol Weight 268.32 g/mol
Molecular Formula C15H16N4O
Exact Mass 268.132411 g/mol