Wiley SpectraBase; SpectraBase Compound ID=250TPMIWeC
http://spectrabase.com/compound/250TPMIWeC (accessed Oct 29, 2020).

4-(p-nitrophenyl)-3-phenyl-3-buten-2-one
SpectraBase Compound ID 250TPMIWeC
InChI InChI=1S/C16H13NO3/c1-12(18)16(14-5-3-2-4-6-14)11-13-7-9-15(10-8-13)17(19)20/h2-11H,1H3
InChIKey HIZKXJSFBMISQL-UHFFFAOYSA-N
Mol Weight 267.28 g/mol
Molecular Formula C16H13NO3
Exact Mass 267.089543 g/mol