Wiley SpectraBase; SpectraBase Compound ID=23EpNVz4ji
http://spectrabase.com/compound/23EpNVz4ji (accessed Oct 27, 2020).

2,6-DIAMINO-9-(BETA-D-XYLOFURANOSYL)-PURINE
SpectraBase Compound ID 23EpNVz4ji
InChI InChI=1S/C10H14N6O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H4,11,12,14,15)/t3-,5+,6-,9-/m0/s1
InChIKey ZDTFMPXQUSBYRL-HFXAWCPLSA-N
Mol Weight 282.26 g/mol
Molecular Formula C10H14N6O4
Exact Mass 282.107653 g/mol
Enantiomer InChIKey ZDTFMPXQUSBYRL-FTWQFJAYSA-N