Wiley SpectraBase; SpectraBase Compound ID=238JFKjpXY
http://spectrabase.com/compound/238JFKjpXY (accessed Oct 29, 2020).

PANAXYDOL
SpectraBase Compound ID 238JFKjpXY
InChI InChI=1S/C17H24O2/c1-3-5-6-7-10-13-16-17(19-16)14-11-8-9-12-15(18)4-2/h4,15-18H,2-3,5-7,10,13-14H2,1H3/t15-,16+,17-/m1/s1/i4+1
InChIKey GVLDSGIQZAFIAN-CWKTUTJXSA-N
Mol Weight 261.37 g/mol
Molecular Formula C1613CH24O2
Exact Mass 261.180985 g/mol
Enantiomer InChIKey GVLDSGIQZAFIAN-UGQRDDIVSA-N