Wiley SpectraBase; SpectraBase Compound ID=22Nn2m5qYw
http://spectrabase.com/compound/22Nn2m5qYw (accessed Oct 27, 2020).

2'-O-ACETOXYETHYL-2-THIOURIDINE
SpectraBase Compound ID 22Nn2m5qYw
InChI InChI=1S/C13H18N2O7S/c1-7(17)20-4-5-21-11-10(19)8(6-16)22-12(11)15-3-2-9(18)14-13(15)23/h2-3,8,10-12,16,19H,4-6H2,1H3,(H,14,18,23)/t8-,10-,11-,12-/m1/s1
InChIKey NQSNTUJCHMHROH-HJQYOEGKSA-N
Mol Weight 346.35 g/mol
Molecular Formula C13H18N2O7S
Exact Mass 346.083473 g/mol
Enantiomer InChIKey NQSNTUJCHMHROH-VGDYDELISA-N