Wiley SpectraBase; SpectraBase Compound ID=21quDaxlGo
http://spectrabase.com/compound/21quDaxlGo (accessed Oct 25, 2020).

2,6-DIFLUORO-4-(2,6-DIFLUOROPHENYL)-BENZOIC-ACID
SpectraBase Compound ID 21quDaxlGo
InChI InChI=1S/C13H6F4O2/c14-7-2-1-3-8(15)11(7)6-4-9(16)12(13(18)19)10(17)5-6/h1-5H,(H,18,19)
InChIKey FCBFMAUSCIFRMR-UHFFFAOYSA-N
Mol Weight 270.18 g/mol
Molecular Formula C13H6F4O2
Exact Mass 270.030393 g/mol