Wiley SpectraBase; SpectraBase Compound ID=1zDl6gUIsK
http://spectrabase.com/compound/1zDl6gUIsK (accessed Oct 28, 2020).

ethyl 2-(4,5,6,7,8,9-hexahydrocycloocta[d]selenadiazol-3-ium-3-yl)acetate
SpectraBase Compound ID 1zDl6gUIsK
InChI InChI=1S/C12H19N2O2Se/c1-2-16-12(15)9-14-10-7-5-3-4-6-8-11(10)17-13-14/h2-9H2,1H3/q+1
InChIKey QGEPIFDXMAPMFF-UHFFFAOYSA-N
Mol Weight 302.27 g/mol
Molecular Formula C12H19N2O2Se
Exact Mass 303.061173 g/mol