Wiley SpectraBase; SpectraBase Compound ID=1yxewK8KvlE
http://spectrabase.com/compound/1yxewK8KvlE (accessed Oct 27, 2020).

1-methyl-4-propylpyrrole-2-carbonitrile
SpectraBase Compound ID 1yxewK8KvlE
InChI InChI=1S/C9H12N2/c1-3-4-8-5-9(6-10)11(2)7-8/h5,7H,3-4H2,1-2H3
InChIKey FKIOGOQFLUFJJO-UHFFFAOYSA-N
Mol Weight 148.21 g/mol
Molecular Formula C9H12N2
Exact Mass 148.100048 g/mol