Wiley SpectraBase; SpectraBase Compound ID=1vhXfLkVrt
http://spectrabase.com/compound/1vhXfLkVrt (accessed Oct 26, 2020).

(5AS,6AS,10S/R,10AR/5AR,6AR,10R/S,10AS)-4,7-DIMETHYL-4,5,5A,6,6A,7,8,9,10,10A-DECAHYDROINDOLO-[4,3-FG]-QUINOLIN-10-OL
SpectraBase Compound ID 1vhXfLkVrt
InChI InChI=1S/C16H22N2O/c1-17-7-6-14(19)16-11-4-3-5-12-15(11)10(8-13(16)17)9-18(12)2/h3-5,10,13-14,16,19H,6-9H2,1-2H3/t10-,13+,14?,16-/m1/s1
InChIKey YTJVJPGRXKWXCM-XFHRRJHJSA-N
Mol Weight 258.36 g/mol
Molecular Formula C16H22N2O
Exact Mass 258.173213 g/mol
Enantiomer InChIKey YTJVJPGRXKWXCM-ABNOQUHFSA-N