Wiley SpectraBase; SpectraBase Compound ID=1o3uyxd5C5
http://spectrabase.com/compound/1o3uyxd5C5 (accessed Oct 20, 2020).

2-Ethylphenyl acetate
SpectraBase Compound ID 1o3uyxd5C5
InChI InChI=1S/C10H12O2/c1-3-9-6-4-5-7-10(9)12-8(2)11/h4-7H,3H2,1-2H3
InChIKey VERVERDPMMBDSS-UHFFFAOYSA-N
Mol Weight 164.2 g/mol
Molecular Formula C10H12O2
Exact Mass 164.08373 g/mol