Wiley SpectraBase; SpectraBase Compound ID=1nyok93VXZ
http://spectrabase.com/compound/1nyok93VXZ (accessed Oct 25, 2020).

(1S,5R)-6-ISOPROPYL-6-AZABICYCLO-[3.2.1]-OCT-3-ENE-7,8-DIONE
SpectraBase Compound ID 1nyok93VXZ
InChI InChI=1S/C10H13NO2/c1-6(2)11-8-5-3-4-7(9(8)12)10(11)13/h3,5-8H,4H2,1-2H3/t7-,8+/m0/s1
InChIKey LGOILQAECHJWOE-JGVFFNPUSA-N
Mol Weight 179.22 g/mol
Molecular Formula C10H13NO2
Exact Mass 179.094629 g/mol
Enantiomer InChIKey LGOILQAECHJWOE-SFYZADRCSA-N