Wiley SpectraBase; SpectraBase Compound ID=1ht0apAP9f
http://spectrabase.com/compound/1ht0apAP9f (accessed Oct 26, 2020).

DEHYDROJUNCUENIN_A
SpectraBase Compound ID 1ht0apAP9f
InChI InChI=1S/C18H16O/c1-4-13-10-17-14(9-11(13)2)5-6-15-12(3)18(19)8-7-16(15)17/h4-10,19H,1H2,2-3H3
InChIKey ZUJPWASMQHMHLE-UHFFFAOYSA-N
Mol Weight 248.32 g/mol
Molecular Formula C18H16O
Exact Mass 248.120115 g/mol