Wiley SpectraBase; SpectraBase Compound ID=1ZRkwao1ho
http://spectrabase.com/compound/1ZRkwao1ho (accessed Oct 20, 2020).

3-PROPYLQUINAZOLIN-4-ONE
SpectraBase Compound ID 1ZRkwao1ho
InChI InChI=1S/C11H12N2O/c1-2-7-13-8-12-10-6-4-3-5-9(10)11(13)14/h3-6,8H,2,7H2,1H3
InChIKey XUULXKORCSQLNN-UHFFFAOYSA-N
Mol Weight 188.23 g/mol
Molecular Formula C11H12N2O
Exact Mass 188.094963 g/mol